C37H57NO7Si — CID 140700052
[(3R,4S,6R)-2-[(3S,4R,5R,7R)-8-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-3,5,7-trimethyloct-1-en-4-yl]oxy-4-(dimethylamino)-6-methyloxan-3-yl] methyl carbonate (PubChem CID 140700052) has the molecular formula C37H57NO7Si and a molecular weight of 655.95 g/mol. Its IUPAC name is [(3R,4S,6R)-2-[(3S,4R,5R,7R)-8-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-3,5,7-trimethyloct-1-en-4-yl]oxy-4-(dimethylamino)-6-methyloxan-3-yl] methyl carbonate.
| Compound Name | [(3R,4S,6R)-2-[(3S,4R,5R,7R)-8-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-3,5,7-trimethyloct-1-en-4-yl]oxy-4-(dimethylamino)-6-methyloxan-3-yl] methyl carbonate |
|---|---|
| PubChem CID | 140700052 |
| Molecular Formula | C37H57NO7Si |
| Molecular Weight | 655.95 g/mol |
| Exact Mass | 655.39 |
| IUPAC Name | [(3R,4S,6R)-2-[(3S,4R,5R,7R)-8-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-3,5,7-trimethyloct-1-en-4-yl]oxy-4-(dimethylamino)-6-methyloxan-3-yl] methyl carbonate |
| SMILES | C=C[C@H](C)[C@@H](OC1O[C@H](C)C[C@H](N(C)C)[C@H]1OC(=O)OC)[C@](C)(O)C[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C37H57NO7Si/c1-12-27(3)33(45-34-32(44-35(39)41-11)31(38(9)10)23-28(4)43-34)37(8,40)24-26(2)25-42-46(36(5,6)7,29-19-15-13-16-20-29)30-21-17-14-18-22-30/h12-22,26-28,31-34,40H,1,23-25H2,2-11H3/t26-,27+,28-,31+,32-,33-,34?,37-/m1/s1 |
| InChIKey | QCAUJMATNLTNLR-FKBGSQDGSA-N |
| XLogP | 5.76 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.95 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|