C21H27ClN2O2 — CID 140700138
N-[[(1R,3R)-3-(chloromethyl)-2-cyclobutyl-1-hydroxycyclohexyl]methyl]indolizine-1-carboxamide (PubChem CID 140700138) has the molecular formula C21H27ClN2O2 and a molecular weight of 374.91 g/mol. Its IUPAC name is N-[[(1R,3R)-3-(chloromethyl)-2-cyclobutyl-1-hydroxycyclohexyl]methyl]indolizine-1-carboxamide.
| Compound Name | N-[[(1R,3R)-3-(chloromethyl)-2-cyclobutyl-1-hydroxycyclohexyl]methyl]indolizine-1-carboxamide |
|---|---|
| PubChem CID | 140700138 |
| Molecular Formula | C21H27ClN2O2 |
| Molecular Weight | 374.91 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | N-[[(1R,3R)-3-(chloromethyl)-2-cyclobutyl-1-hydroxycyclohexyl]methyl]indolizine-1-carboxamide |
| SMILES | O=C(NC[C@@]1(O)CCC[C@@H](CCl)C1C1CCC1)c1ccn2ccccc12 |
| InChI | InChI=1S/C21H27ClN2O2/c22-13-16-7-4-10-21(26,19(16)15-5-3-6-15)14-23-20(25)17-9-12-24-11-2-1-8-18(17)24/h1-2,8-9,11-12,15-16,19,26H,3-7,10,13-14H2,(H,23,25)/t16-,19?,21-/m0/s1 |
| InChIKey | BGRVEQJGERGENX-NUOXSBERSA-N |
| XLogP | 3.86 |
| TPSA | 53.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.91 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|