C25H23F3N4O — CID 140701003
4-[4-(3-tert-butylphenoxazin-10-yl)-2-pyridinyl]-1,1,1-trifluoro-4-iminobut-2-en-2-amine (PubChem CID 140701003) has the molecular formula C25H23F3N4O and a molecular weight of 452.48 g/mol. Its IUPAC name is 4-[4-(3-tert-butylphenoxazin-10-yl)-2-pyridinyl]-1,1,1-trifluoro-4-iminobut-2-en-2-amine.
| Compound Name | 4-[4-(3-tert-butylphenoxazin-10-yl)-2-pyridinyl]-1,1,1-trifluoro-4-iminobut-2-en-2-amine |
|---|---|
| PubChem CID | 140701003 |
| Molecular Formula | C25H23F3N4O |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 4-[4-(3-tert-butylphenoxazin-10-yl)-2-pyridinyl]-1,1,1-trifluoro-4-iminobut-2-en-2-amine |
| SMILES | [H]/N=C(\C=C(N)C(F)(F)F)c1cc(N2c3ccccc3Oc3cc(C(C)(C)C)ccc32)ccn1 |
| InChI | InChI=1S/C25H23F3N4O/c1-24(2,3)15-8-9-20-22(12-15)33-21-7-5-4-6-19(21)32(20)16-10-11-31-18(13-16)17(29)14-23(30)25(26,27)28/h4-14,29H,30H2,1-3H3/b23-14?,29-17+ |
| InChIKey | LPHOMAOLAHLQKZ-JPYAWUKVSA-N |
| XLogP | 6.73 |
| TPSA | 75.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|