C52H57ClF3N7Ru — CID 140701036
N,N-bis(4-pentylphenyl)-2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridin-4-amine;chlororuthenium(1+);4-ethyl-2,6-bis(4-ethyl-2-pyridinyl)pyridine (PubChem CID 140701036) has the molecular formula C52H57ClF3N7Ru and a molecular weight of 973.59 g/mol. Its IUPAC name is N,N-bis(4-pentylphenyl)-2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridin-4-amine;chlororuthenium(1+);4-ethyl-2,6-bis(4-ethyl-2-pyridinyl)pyridine.
| Compound Name | N,N-bis(4-pentylphenyl)-2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridin-4-amine;chlororuthenium(1+);4-ethyl-2,6-bis(4-ethyl-2-pyridinyl)pyridine |
|---|---|
| PubChem CID | 140701036 |
| Molecular Formula | C52H57ClF3N7Ru |
| Molecular Weight | 973.59 g/mol |
| Exact Mass | 973.34 |
| IUPAC Name | N,N-bis(4-pentylphenyl)-2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridin-4-amine;chlororuthenium(1+);4-ethyl-2,6-bis(4-ethyl-2-pyridinyl)pyridine |
| SMILES | CCCCCc1ccc(N(c2ccc(CCCCC)cc2)c2ccnc(-c3cc(C(F)(F)F)n[n-]3)c2)cc1.CCc1ccnc(-c2cc(CC)cc(-c3cc(CC)ccn3)n2)c1.Cl[Ru+] |
| InChI | InChI=1S/C31H34F3N4.C21H23N3.ClH.Ru/c1-3-5-7-9-23-11-15-25(16-12-23)38(26-17-13-24(14-18-26)10-8-6-4-2)27-19-20-35-28(21-27)29-22-30(37-36-29)31(32,33)34;1-4-15-7-9-22-18(11-15)20-13-17(6-3)14-21(24-20)19-12-16(5-2)8-10-23-19;;/h11-22H,3-10H2,1-2H3;7-14H,4-6H2,1-3H3;1H;/q-1;;;+2/p-1 |
| InChIKey | KBLRERQVVSVFAY-UHFFFAOYSA-M |
| XLogP | 14.63 |
| TPSA | 81.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 973.59 |
| LogP ≤ 5 | 14.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|