C39H25F3N4O2 — CID 140701112
N-[4-[2-[(Z)-1-amino-4,4,4-trifluoro-3-iminobut-1-enyl]-4-pyridinyl]phenyl]-N-dibenzofuran-2-yldibenzofuran-3-amine (PubChem CID 140701112) has the molecular formula C39H25F3N4O2 and a molecular weight of 638.65 g/mol. Its IUPAC name is N-[4-[2-[(Z)-1-amino-4,4,4-trifluoro-3-iminobut-1-enyl]-4-pyridinyl]phenyl]-N-dibenzofuran-2-yldibenzofuran-3-amine.
| Compound Name | N-[4-[2-[(Z)-1-amino-4,4,4-trifluoro-3-iminobut-1-enyl]-4-pyridinyl]phenyl]-N-dibenzofuran-2-yldibenzofuran-3-amine |
|---|---|
| PubChem CID | 140701112 |
| Molecular Formula | C39H25F3N4O2 |
| Molecular Weight | 638.65 g/mol |
| Exact Mass | 638.19 |
| IUPAC Name | N-[4-[2-[(Z)-1-amino-4,4,4-trifluoro-3-iminobut-1-enyl]-4-pyridinyl]phenyl]-N-dibenzofuran-2-yldibenzofuran-3-amine |
| SMILES | [H]/N=C(/C=C(\N)c1cc(-c2ccc(N(c3ccc4c(c3)oc3ccccc34)c3ccc4oc5ccccc5c4c3)cc2)ccn1)C(F)(F)F |
| InChI | InChI=1S/C39H25F3N4O2/c40-39(41,42)38(44)22-32(43)33-19-24(17-18-45-33)23-9-11-25(12-10-23)46(26-14-16-36-31(20-26)29-6-2-4-8-35(29)47-36)27-13-15-30-28-5-1-3-7-34(28)48-37(30)21-27/h1-22,44H,43H2/b32-22-,44-38- |
| InChIKey | VVTIKDZKPNAHQS-RLHSBOLASA-N |
| XLogP | 10.90 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.65 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|