C33H21F3N4O2 — CID 140701130
2-[(Z)-1-amino-4,4,4-trifluoro-3-iminobut-1-enyl]-N-dibenzofuran-2-yl-N-dibenzofuran-3-ylpyridin-4-amine (PubChem CID 140701130) has the molecular formula C33H21F3N4O2 and a molecular weight of 562.55 g/mol. Its IUPAC name is 2-[(Z)-1-amino-4,4,4-trifluoro-3-iminobut-1-enyl]-N-dibenzofuran-2-yl-N-dibenzofuran-3-ylpyridin-4-amine.
| Compound Name | 2-[(Z)-1-amino-4,4,4-trifluoro-3-iminobut-1-enyl]-N-dibenzofuran-2-yl-N-dibenzofuran-3-ylpyridin-4-amine |
|---|---|
| PubChem CID | 140701130 |
| Molecular Formula | C33H21F3N4O2 |
| Molecular Weight | 562.55 g/mol |
| Exact Mass | 562.16 |
| IUPAC Name | 2-[(Z)-1-amino-4,4,4-trifluoro-3-iminobut-1-enyl]-N-dibenzofuran-2-yl-N-dibenzofuran-3-ylpyridin-4-amine |
| SMILES | [H]/N=C(/C=C(\N)c1cc(N(c2ccc3c(c2)oc2ccccc23)c2ccc3oc4ccccc4c3c2)ccn1)C(F)(F)F |
| InChI | InChI=1S/C33H21F3N4O2/c34-33(35,36)32(38)18-26(37)27-16-21(13-14-39-27)40(19-10-12-30-25(15-19)23-6-2-4-8-29(23)41-30)20-9-11-24-22-5-1-3-7-28(22)42-31(24)17-20/h1-18,38H,37H2/b26-18-,38-32- |
| InChIKey | OHWWANOKWBQLCA-IKARVWLQSA-N |
| XLogP | 9.23 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.55 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|