C31H33F3N4 — CID 140701165
N-[2-[6-(3-amino-4,4,4-trifluorobut-2-enimidoyl)-3-pyridinyl]ethynyl]-4-tert-butyl-N-(4-tert-butylphenyl)aniline (PubChem CID 140701165) has the molecular formula C31H33F3N4 and a molecular weight of 518.63 g/mol. Its IUPAC name is N-[2-[6-(3-amino-4,4,4-trifluorobut-2-enimidoyl)-3-pyridinyl]ethynyl]-4-tert-butyl-N-(4-tert-butylphenyl)aniline.
| Compound Name | N-[2-[6-(3-amino-4,4,4-trifluorobut-2-enimidoyl)-3-pyridinyl]ethynyl]-4-tert-butyl-N-(4-tert-butylphenyl)aniline |
|---|---|
| PubChem CID | 140701165 |
| Molecular Formula | C31H33F3N4 |
| Molecular Weight | 518.63 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | N-[2-[6-(3-amino-4,4,4-trifluorobut-2-enimidoyl)-3-pyridinyl]ethynyl]-4-tert-butyl-N-(4-tert-butylphenyl)aniline |
| SMILES | [H]/N=C(\C=C(N)C(F)(F)F)c1ccc(C#CN(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cn1 |
| InChI | InChI=1S/C31H33F3N4/c1-29(2,3)22-8-12-24(13-9-22)38(25-14-10-23(11-15-25)30(4,5)6)18-17-21-7-16-27(37-20-21)26(35)19-28(36)31(32,33)34/h7-16,19-20,35H,36H2,1-6H3/b28-19?,35-26+ |
| InChIKey | AOPMSXMXZRDGAH-MPWIEZFHSA-N |
| XLogP | 7.60 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.63 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|