C26H16F2N4 — CID 140701396
5-[4-(3-cyano-4-fluoro-5-isocyanophenyl)-2,3,5,6-tetramethylphenyl]-2-fluoro-3-isocyanobenzonitrile (PubChem CID 140701396) has the molecular formula C26H16F2N4 and a molecular weight of 422.44 g/mol. Its IUPAC name is 5-[4-(3-cyano-4-fluoro-5-isocyanophenyl)-2,3,5,6-tetramethylphenyl]-2-fluoro-3-isocyanobenzonitrile.
| Compound Name | 5-[4-(3-cyano-4-fluoro-5-isocyanophenyl)-2,3,5,6-tetramethylphenyl]-2-fluoro-3-isocyanobenzonitrile |
|---|---|
| PubChem CID | 140701396 |
| Molecular Formula | C26H16F2N4 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 5-[4-(3-cyano-4-fluoro-5-isocyanophenyl)-2,3,5,6-tetramethylphenyl]-2-fluoro-3-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cc(-c2c(C)c(C)c(-c3cc(C#N)c(F)c([N+]#[C-])c3)c(C)c2C)cc(C#N)c1F |
| InChI | InChI=1S/C26H16F2N4/c1-13-14(2)24(18-8-20(12-30)26(28)22(10-18)32-6)16(4)15(3)23(13)17-7-19(11-29)25(27)21(9-17)31-5/h7-10H,1-4H3 |
| InChIKey | RGSNMNPCIKGOKS-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 56.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|