About 2-fluoro-3-isocyano-4,6-bis(3-phenylphenyl)benzonitrile
2-fluoro-3-isocyano-4,6-bis(3-phenylphenyl)benzonitrile (PubChem CID 140701407) has the molecular formula C32H19FN2
and a molecular weight of 450.52 g/mol. Its IUPAC name is 2-fluoro-3-isocyano-4,6-bis(3-phenylphenyl)benzonitrile.
Molecular Properties
| Compound Name | 2-fluoro-3-isocyano-4,6-bis(3-phenylphenyl)benzonitrile |
| PubChem CID | 140701407 |
| Molecular Formula | C32H19FN2 |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 2-fluoro-3-isocyano-4,6-bis(3-phenylphenyl)benzonitrile |
| SMILES | [C-]#[N+]c1c(-c2cccc(-c3ccccc3)c2)cc(-c2cccc(-c3ccccc3)c2)c(C#N)c1F |
| InChI | InChI=1S/C32H19FN2/c1-35-32-29(27-17-9-15-25(19-27)23-12-6-3-7-13-23)20-28(30(21-34)31(32)33)26-16-8-14-24(18-26)22-10-4-2-5-11-22/h2-20H |
| InChIKey | VVLROIAZFLCMEM-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-3-isocyano-4,6-bis(3-phenylphenyl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-3-isocyano-4,6-bis(3-phenylphenyl)benzonitrile?
The IUPAC name of 2-fluoro-3-isocyano-4,6-bis(3-phenylphenyl)benzonitrile (CID 140701407) is 2-fluoro-3-isocyano-4,6-bis(3-phenylphenyl)benzonitrile.
What is the SMILES notation for 2-fluoro-3-isocyano-4,6-bis(3-phenylphenyl)benzonitrile?
The canonical SMILES for 2-fluoro-3-isocyano-4,6-bis(3-phenylphenyl)benzonitrile is [C-]#[N+]c1c(-c2cccc(-c3ccccc3)c2)cc(-c2cccc(-c3ccccc3)c2)c(C#N)c1F.
What is the InChIKey of 2-fluoro-3-isocyano-4,6-bis(3-phenylphenyl)benzonitrile?
The InChIKey is VVLROIAZFLCMEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H19FN2/c1-35-32-29(27-17-9-15-25(19-27)23-12-6-3-7-13-23)20-28(30(21-34)31(32)33)26-16-8-14-24(18-26)22-10-4-2-5-11-22/h2-20H.
What are the key properties of 2-fluoro-3-isocyano-4,6-bis(3-phenylphenyl)benzonitrile?
2-fluoro-3-isocyano-4,6-bis(3-phenylphenyl)benzonitrile has a molecular weight of 450.52 g/mol, XLogP of 8.92, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-3-isocyano-4,6-bis(3-phenylphenyl)benzonitrile is sourced from PubChem (CID 140701407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).