C18H22F2N4O4S — CID 140701880
tert-butyl N-[[(1S,5S,6S)-3-amino-5-(2,3-difluoro-5-nitrophenyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-1-yl]methyl]carbamate (PubChem CID 140701880) has the molecular formula C18H22F2N4O4S and a molecular weight of 428.46 g/mol. Its IUPAC name is tert-butyl N-[[(1S,5S,6S)-3-amino-5-(2,3-difluoro-5-nitrophenyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-1-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(1S,5S,6S)-3-amino-5-(2,3-difluoro-5-nitrophenyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-1-yl]methyl]carbamate |
|---|---|
| PubChem CID | 140701880 |
| Molecular Formula | C18H22F2N4O4S |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | tert-butyl N-[[(1S,5S,6S)-3-amino-5-(2,3-difluoro-5-nitrophenyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-1-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@]12C[C@H]1[C@@](C)(c1cc([N+](=O)[O-])cc(F)c1F)N=C(N)S2 |
| InChI | InChI=1S/C18H22F2N4O4S/c1-16(2,3)28-15(25)22-8-18-7-12(18)17(4,23-14(21)29-18)10-5-9(24(26)27)6-11(19)13(10)20/h5-6,12H,7-8H2,1-4H3,(H2,21,23)(H,22,25)/t12-,17+,18+/m0/s1 |
| InChIKey | DOWDJGPGUBRKLI-JBBXEZCESA-N |
| XLogP | 3.43 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|