C28H36F2N6O3Si — CID 140702516
5-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-[1-[(4-ethoxy-2,6-difluorophenyl)methyl]indazol-3-yl]pyrimidine-4,6-diamine (PubChem CID 140702516) has the molecular formula C28H36F2N6O3Si and a molecular weight of 570.72 g/mol. Its IUPAC name is 5-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-[1-[(4-ethoxy-2,6-difluorophenyl)methyl]indazol-3-yl]pyrimidine-4,6-diamine.
| Compound Name | 5-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-[1-[(4-ethoxy-2,6-difluorophenyl)methyl]indazol-3-yl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 140702516 |
| Molecular Formula | C28H36F2N6O3Si |
| Molecular Weight | 570.72 g/mol |
| Exact Mass | 570.26 |
| IUPAC Name | 5-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-[1-[(4-ethoxy-2,6-difluorophenyl)methyl]indazol-3-yl]pyrimidine-4,6-diamine |
| SMILES | CCOc1cc(F)c(Cn2nc(-c3nc(N)c(OCCO[Si](C)(C)C(C)(C)C)c(N)n3)c3ccccc32)c(F)c1 |
| InChI | InChI=1S/C28H36F2N6O3Si/c1-7-37-17-14-20(29)19(21(30)15-17)16-36-22-11-9-8-10-18(22)23(35-36)27-33-25(31)24(26(32)34-27)38-12-13-39-40(5,6)28(2,3)4/h8-11,14-15H,7,12-13,16H2,1-6H3,(H4,31,32,33,34) |
| InChIKey | YPBCHVAVMCBFRM-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 123.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.72 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|