C25H36AlNO — CID 140702846
1-(3,5-ditert-butyl-2-dimethylalumanyloxyphenyl)-N-[(1S)-1-phenylethyl]methanimine (PubChem CID 140702846) has the molecular formula C25H36AlNO and a molecular weight of 393.55 g/mol. Its IUPAC name is 1-(3,5-ditert-butyl-2-dimethylalumanyloxyphenyl)-N-[(1S)-1-phenylethyl]methanimine.
| Compound Name | 1-(3,5-ditert-butyl-2-dimethylalumanyloxyphenyl)-N-[(1S)-1-phenylethyl]methanimine |
|---|---|
| PubChem CID | 140702846 |
| Molecular Formula | C25H36AlNO |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.26 |
| IUPAC Name | 1-(3,5-ditert-butyl-2-dimethylalumanyloxyphenyl)-N-[(1S)-1-phenylethyl]methanimine |
| SMILES | C[C@H](/N=C/c1cc(C(C)(C)C)cc(C(C)(C)C)c1O[Al](C)C)c1ccccc1 |
| InChI | InChI=1S/C23H31NO.2CH3.Al/c1-16(17-11-9-8-10-12-17)24-15-18-13-19(22(2,3)4)14-20(21(18)25)23(5,6)7;;;/h8-16,25H,1-7H3;2*1H3;/q;;;+1/p-1/b24-15+;;;/t16-;;;/m0.../s1 |
| InChIKey | SMUFOURHMDQIKH-HCYNZPRYSA-M |
| XLogP | 7.09 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|