C27H40O4Si — CID 140702952
(2R,4R)-5-[tert-butyl(diphenyl)silyl]oxy-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylpentan-2-ol (PubChem CID 140702952) has the molecular formula C27H40O4Si and a molecular weight of 456.70 g/mol. Its IUPAC name is (2R,4R)-5-[tert-butyl(diphenyl)silyl]oxy-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylpentan-2-ol.
| Compound Name | (2R,4R)-5-[tert-butyl(diphenyl)silyl]oxy-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylpentan-2-ol |
|---|---|
| PubChem CID | 140702952 |
| Molecular Formula | C27H40O4Si |
| Molecular Weight | 456.70 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | (2R,4R)-5-[tert-butyl(diphenyl)silyl]oxy-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylpentan-2-ol |
| SMILES | C[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C[C@@](C)(O)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C27H40O4Si/c1-21(18-27(7,28)24-20-29-26(5,6)31-24)19-30-32(25(2,3)4,22-14-10-8-11-15-22)23-16-12-9-13-17-23/h8-17,21,24,28H,18-20H2,1-7H3/t21-,24-,27-/m1/s1 |
| InChIKey | UVEZSDNHENLLEL-GNMGOMLTSA-N |
| XLogP | 4.49 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.70 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|