C38H47NO3Si — CID 140703082
(2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-N-[(1R,2R)-2-hydroxy-1,2-diphenylethyl]-N,2,4-trimethylpentanamide (PubChem CID 140703082) has the molecular formula C38H47NO3Si and a molecular weight of 593.88 g/mol. Its IUPAC name is (2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-N-[(1R,2R)-2-hydroxy-1,2-diphenylethyl]-N,2,4-trimethylpentanamide.
| Compound Name | (2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-N-[(1R,2R)-2-hydroxy-1,2-diphenylethyl]-N,2,4-trimethylpentanamide |
|---|---|
| PubChem CID | 140703082 |
| Molecular Formula | C38H47NO3Si |
| Molecular Weight | 593.88 g/mol |
| Exact Mass | 593.33 |
| IUPAC Name | (2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-N-[(1R,2R)-2-hydroxy-1,2-diphenylethyl]-N,2,4-trimethylpentanamide |
| SMILES | C[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C[C@H](C)C(=O)N(C)[C@H](c1ccccc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C38H47NO3Si/c1-29(28-42-43(38(3,4)5,33-23-15-9-16-24-33)34-25-17-10-18-26-34)27-30(2)37(41)39(6)35(31-19-11-7-12-20-31)36(40)32-21-13-8-14-22-32/h7-26,29-30,35-36,40H,27-28H2,1-6H3/t29-,30+,35-,36-/m1/s1 |
| InChIKey | GLFCXQVRFUCDMZ-ANCUJIGRSA-N |
| XLogP | 7.16 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.88 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|