C25H32F3NO6SSi — CID 140703139
[(4R,5S)-5-[(1R)-1-[tert-butyl(diphenyl)silyl]oxypropyl]-5-methyl-2-oxo-1,3-oxazolidin-4-yl]methyl trifluoromethanesulfonate (PubChem CID 140703139) has the molecular formula C25H32F3NO6SSi and a molecular weight of 559.68 g/mol. Its IUPAC name is [(4R,5S)-5-[(1R)-1-[tert-butyl(diphenyl)silyl]oxypropyl]-5-methyl-2-oxo-1,3-oxazolidin-4-yl]methyl trifluoromethanesulfonate.
| Compound Name | [(4R,5S)-5-[(1R)-1-[tert-butyl(diphenyl)silyl]oxypropyl]-5-methyl-2-oxo-1,3-oxazolidin-4-yl]methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 140703139 |
| Molecular Formula | C25H32F3NO6SSi |
| Molecular Weight | 559.68 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | [(4R,5S)-5-[(1R)-1-[tert-butyl(diphenyl)silyl]oxypropyl]-5-methyl-2-oxo-1,3-oxazolidin-4-yl]methyl trifluoromethanesulfonate |
| SMILES | CC[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@]1(C)OC(=O)N[C@@H]1COS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C25H32F3NO6SSi/c1-6-21(24(5)20(29-22(30)34-24)17-33-36(31,32)25(26,27)28)35-37(23(2,3)4,18-13-9-7-10-14-18)19-15-11-8-12-16-19/h7-16,20-21H,6,17H2,1-5H3,(H,29,30)/t20-,21-,24+/m1/s1 |
| InChIKey | IZFSGPVIDCIJJM-LGVFNWMJSA-N |
| XLogP | 4.07 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.68 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|