C8H17N3OS — CID 14070320
5-(2-hydroxypropyl)-1,3-dimethyl-1,3,5-triazinane-2-thione (PubChem CID 14070320) has the molecular formula C8H17N3OS and a molecular weight of 203.31 g/mol. Its IUPAC name is 5-(2-hydroxypropyl)-1,3-dimethyl-1,3,5-triazinane-2-thione.
| Compound Name | 5-(2-hydroxypropyl)-1,3-dimethyl-1,3,5-triazinane-2-thione |
|---|---|
| PubChem CID | 14070320 |
| Molecular Formula | C8H17N3OS |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 5-(2-hydroxypropyl)-1,3-dimethyl-1,3,5-triazinane-2-thione |
| SMILES | CC(O)CN1CN(C)C(=S)N(C)C1 |
| InChI | InChI=1S/C8H17N3OS/c1-7(12)4-11-5-9(2)8(13)10(3)6-11/h7,12H,4-6H2,1-3H3 |
| InChIKey | SBDDYPHJOIZJAB-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|