C33H48O6Si — CID 140703209
6-[(2R,3R,4R,6R)-7-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-4-methoxy-4,6-dimethylheptan-2-yl]-2,2,5-trimethyl-1,3-dioxin-4-one (PubChem CID 140703209) has the molecular formula C33H48O6Si and a molecular weight of 568.83 g/mol. Its IUPAC name is 6-[(2R,3R,4R,6R)-7-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-4-methoxy-4,6-dimethylheptan-2-yl]-2,2,5-trimethyl-1,3-dioxin-4-one.
| Compound Name | 6-[(2R,3R,4R,6R)-7-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-4-methoxy-4,6-dimethylheptan-2-yl]-2,2,5-trimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 140703209 |
| Molecular Formula | C33H48O6Si |
| Molecular Weight | 568.83 g/mol |
| Exact Mass | 568.32 |
| IUPAC Name | 6-[(2R,3R,4R,6R)-7-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-4-methoxy-4,6-dimethylheptan-2-yl]-2,2,5-trimethyl-1,3-dioxin-4-one |
| SMILES | CO[C@](C)(C[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](O)[C@@H](C)C1=C(C)C(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C33H48O6Si/c1-23(21-33(9,36-10)29(34)24(2)28-25(3)30(35)39-32(7,8)38-28)22-37-40(31(4,5)6,26-17-13-11-14-18-26)27-19-15-12-16-20-27/h11-20,23-24,29,34H,21-22H2,1-10H3/t23-,24+,29-,33-/m1/s1 |
| InChIKey | RMXSXVOXDXNJQH-MQHGREONSA-N |
| XLogP | 5.57 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.83 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|