C9H18N6S2 — CID 14070322
5-[3-(4-sulfanylidene-1,3,5-triazinan-1-yl)propyl]-1,3,5-triazinane-2-thione (PubChem CID 14070322) has the molecular formula C9H18N6S2 and a molecular weight of 274.42 g/mol. Its IUPAC name is 5-[3-(4-sulfanylidene-1,3,5-triazinan-1-yl)propyl]-1,3,5-triazinane-2-thione.
| Compound Name | 5-[3-(4-sulfanylidene-1,3,5-triazinan-1-yl)propyl]-1,3,5-triazinane-2-thione |
|---|---|
| PubChem CID | 14070322 |
| Molecular Formula | C9H18N6S2 |
| Molecular Weight | 274.42 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 5-[3-(4-sulfanylidene-1,3,5-triazinan-1-yl)propyl]-1,3,5-triazinane-2-thione |
| SMILES | S=C1NCN(CCCN2CNC(=S)NC2)CN1 |
| InChI | InChI=1S/C9H18N6S2/c16-8-10-4-14(5-11-8)2-1-3-15-6-12-9(17)13-7-15/h1-7H2,(H2,10,11,16)(H2,12,13,17) |
| InChIKey | ZLGGYMVVTLPZJZ-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.42 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|