C24H29F2N3O5 — CID 140703565
N-[1-[(4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carboxamide (PubChem CID 140703565) has the molecular formula C24H29F2N3O5 and a molecular weight of 477.51 g/mol. Its IUPAC name is N-[1-[(4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carboxamide.
| Compound Name | N-[1-[(4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 140703565 |
| Molecular Formula | C24H29F2N3O5 |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | N-[1-[(4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carboxamide |
| SMILES | CC1(C)CCC(C)(C)c2cc(C(=O)Nc3ccn(C4O[C@H](CO)[C@@H](O)C4(F)F)c(=O)n3)ccc21 |
| InChI | InChI=1S/C24H29F2N3O5/c1-22(2)8-9-23(3,4)15-11-13(5-6-14(15)22)19(32)27-17-7-10-29(21(33)28-17)20-24(25,26)18(31)16(12-30)34-20/h5-7,10-11,16,18,20,30-31H,8-9,12H2,1-4H3,(H,27,28,32,33)/t16-,18-,20?/m1/s1 |
| InChIKey | NKMZEBDNIMFXND-PGBVBIMESA-N |
| XLogP | 2.73 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |