About CID 140705635
CID 140705635 (PubChem CID 140705635) has the molecular formula C34H26IrN4-2
and a molecular weight of 682.83 g/mol.
Molecular Properties
| Compound Name | CID 140705635 |
| PubChem CID | 140705635 |
| Molecular Formula | C34H26IrN4-2 |
| Molecular Weight | 682.83 g/mol |
| Exact Mass | 683.18 |
| IUPAC Name | — |
| SMILES | CC1(C)Cc2cnc3c4[c-]cccc4c4c(-c5ccccc5)ccc1c4n23.[Ir].[c-]1ccccc1-n1cccn1 |
| InChI | InChI=1S/C25H19N2.C9H7N2.Ir/c1-25(2)14-17-15-26-24-20-11-7-6-10-19(20)22-18(16-8-4-3-5-9-16)12-13-21(25)23(22)27(17)24;1-2-5-9(6-3-1)11-8-4-7-10-11;/h3-10,12-13,15H,14H2,1-2H3;1-5,7-8H;/q2*-1; |
| InChIKey | MLJCMYBSTQTLKA-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 35.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 682.83 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 140705635 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140705635?
The IUPAC name of CID 140705635 (CID 140705635) is not available.
What is the SMILES notation for CID 140705635?
The canonical SMILES for CID 140705635 is CC1(C)Cc2cnc3c4[c-]cccc4c4c(-c5ccccc5)ccc1c4n23.[Ir].[c-]1ccccc1-n1cccn1.
What is the InChIKey of CID 140705635?
The InChIKey is MLJCMYBSTQTLKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H19N2.C9H7N2.Ir/c1-25(2)14-17-15-26-24-20-11-7-6-10-19(20)22-18(16-8-4-3-5-9-16)12-13-21(25)23(22)27(17)24;1-2-5-9(6-3-1)11-8-4-7-10-11;/h3-10,12-13,15H,14H2,1-2H3;1-5,7-8H;/q2*-1;.
What are the key properties of CID 140705635?
CID 140705635 has a molecular weight of 682.83 g/mol, XLogP of 7.61, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140705635 is sourced from PubChem (CID 140705635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).