C11H22NO3+ — CID 140706105
[hydroxy-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)methylidene]oxidanium (PubChem CID 140706105) has the molecular formula C11H22NO3+ and a molecular weight of 216.30 g/mol. Its IUPAC name is [hydroxy-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)methylidene]oxidanium.
| Compound Name | [hydroxy-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)methylidene]oxidanium |
|---|---|
| PubChem CID | 140706105 |
| Molecular Formula | C11H22NO3+ |
| Molecular Weight | 216.30 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | [hydroxy-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)methylidene]oxidanium |
| SMILES | [H]/[O+]=C(\O)C1CC(C)(C)N(OC)C(C)(C)C1 |
| InChI | InChI=1S/C11H21NO3/c1-10(2)6-8(9(13)14)7-11(3,4)12(10)15-5/h8H,6-7H2,1-5H3,(H,13,14)/p+1 |
| InChIKey | MARVCMBTUVNHOC-UHFFFAOYSA-O |
| XLogP | 1.88 |
| TPSA | 54.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|