C6H4F6O2 — CID 140706154
1,1,1,5,5,5-hexafluoro-2-methoxypent-3-yn-2-ol (PubChem CID 140706154) has the molecular formula C6H4F6O2 and a molecular weight of 222.08 g/mol. Its IUPAC name is 1,1,1,5,5,5-hexafluoro-2-methoxypent-3-yn-2-ol.
| Compound Name | 1,1,1,5,5,5-hexafluoro-2-methoxypent-3-yn-2-ol |
|---|---|
| PubChem CID | 140706154 |
| Molecular Formula | C6H4F6O2 |
| Molecular Weight | 222.08 g/mol |
| Exact Mass | 222.01 |
| IUPAC Name | 1,1,1,5,5,5-hexafluoro-2-methoxypent-3-yn-2-ol |
| SMILES | COC(O)(C#CC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H4F6O2/c1-14-4(13,6(10,11)12)2-3-5(7,8)9/h13H,1H3 |
| InChIKey | QDBYLVLMBWMRRY-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.08 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|