C16H26O6 — CID 140707014
5,7-dihydroxy-2-(4-hydroxy-3-methoxycyclohexyl)-2,3,4a,5,6,7,8,8a-octahydrochromen-4-one (PubChem CID 140707014) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is 5,7-dihydroxy-2-(4-hydroxy-3-methoxycyclohexyl)-2,3,4a,5,6,7,8,8a-octahydrochromen-4-one.
| Compound Name | 5,7-dihydroxy-2-(4-hydroxy-3-methoxycyclohexyl)-2,3,4a,5,6,7,8,8a-octahydrochromen-4-one |
|---|---|
| PubChem CID | 140707014 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 5,7-dihydroxy-2-(4-hydroxy-3-methoxycyclohexyl)-2,3,4a,5,6,7,8,8a-octahydrochromen-4-one |
| SMILES | COC1CC(C2CC(=O)C3C(O)CC(O)CC3O2)CCC1O |
| InChI | InChI=1S/C16H26O6/c1-21-14-4-8(2-3-10(14)18)13-7-12(20)16-11(19)5-9(17)6-15(16)22-13/h8-11,13-19H,2-7H2,1H3 |
| InChIKey | FKIVLKBLYLMBHU-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |