About [2-chloro-5-(1,3,2-dioxaborolan-2-yl)-4-fluorophenyl]-(6-methoxypyridazin-3-yl)methanol
[2-chloro-5-(1,3,2-dioxaborolan-2-yl)-4-fluorophenyl]-(6-methoxypyridazin-3-yl)methanol (PubChem CID 140707721) has the molecular formula C14H13BClFN2O4
and a molecular weight of 338.53 g/mol. Its IUPAC name is [2-chloro-5-(1,3,2-dioxaborolan-2-yl)-4-fluorophenyl]-(6-methoxypyridazin-3-yl)methanol.
Molecular Properties
| Compound Name | [2-chloro-5-(1,3,2-dioxaborolan-2-yl)-4-fluorophenyl]-(6-methoxypyridazin-3-yl)methanol |
| PubChem CID | 140707721 |
| Molecular Formula | C14H13BClFN2O4 |
| Molecular Weight | 338.53 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | [2-chloro-5-(1,3,2-dioxaborolan-2-yl)-4-fluorophenyl]-(6-methoxypyridazin-3-yl)methanol |
| SMILES | COc1ccc(C(O)c2cc(B3OCCO3)c(F)cc2Cl)nn1 |
| InChI | InChI=1S/C14H13BClFN2O4/c1-21-13-3-2-12(18-19-13)14(20)8-6-9(11(17)7-10(8)16)15-22-4-5-23-15/h2-3,6-7,14,20H,4-5H2,1H3 |
| InChIKey | YIWRRPBOAYCWOS-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 73.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.53 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2-chloro-5-(1,3,2-dioxaborolan-2-yl)-4-fluorophenyl]-(6-methoxypyridazin-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-chloro-5-(1,3,2-dioxaborolan-2-yl)-4-fluorophenyl]-(6-methoxypyridazin-3-yl)methanol?
The IUPAC name of [2-chloro-5-(1,3,2-dioxaborolan-2-yl)-4-fluorophenyl]-(6-methoxypyridazin-3-yl)methanol (CID 140707721) is [2-chloro-5-(1,3,2-dioxaborolan-2-yl)-4-fluorophenyl]-(6-methoxypyridazin-3-yl)methanol.
What is the SMILES notation for [2-chloro-5-(1,3,2-dioxaborolan-2-yl)-4-fluorophenyl]-(6-methoxypyridazin-3-yl)methanol?
The canonical SMILES for [2-chloro-5-(1,3,2-dioxaborolan-2-yl)-4-fluorophenyl]-(6-methoxypyridazin-3-yl)methanol is COc1ccc(C(O)c2cc(B3OCCO3)c(F)cc2Cl)nn1.
What is the InChIKey of [2-chloro-5-(1,3,2-dioxaborolan-2-yl)-4-fluorophenyl]-(6-methoxypyridazin-3-yl)methanol?
The InChIKey is YIWRRPBOAYCWOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13BClFN2O4/c1-21-13-3-2-12(18-19-13)14(20)8-6-9(11(17)7-10(8)16)15-22-4-5-23-15/h2-3,6-7,14,20H,4-5H2,1H3.
What are the key properties of [2-chloro-5-(1,3,2-dioxaborolan-2-yl)-4-fluorophenyl]-(6-methoxypyridazin-3-yl)methanol?
[2-chloro-5-(1,3,2-dioxaborolan-2-yl)-4-fluorophenyl]-(6-methoxypyridazin-3-yl)methanol has a molecular weight of 338.53 g/mol, XLogP of 1.10, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-chloro-5-(1,3,2-dioxaborolan-2-yl)-4-fluorophenyl]-(6-methoxypyridazin-3-yl)methanol is sourced from PubChem (CID 140707721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).