C24H23ClF2N4O4S — CID 140707938
bis[(3-fluorophenyl)methyl] (1R,2S,4S,5R,6R)-2-amino-4-(1H-1,2,4-triazol-5-ylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylate;hydrochloride (PubChem CID 140707938) has the molecular formula C24H23ClF2N4O4S and a molecular weight of 536.99 g/mol. Its IUPAC name is bis[(3-fluorophenyl)methyl] (1R,2S,4S,5R,6R)-2-amino-4-(1H-1,2,4-triazol-5-ylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylate;hydrochloride.
| Compound Name | bis[(3-fluorophenyl)methyl] (1R,2S,4S,5R,6R)-2-amino-4-(1H-1,2,4-triazol-5-ylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylate;hydrochloride |
|---|---|
| PubChem CID | 140707938 |
| Molecular Formula | C24H23ClF2N4O4S |
| Molecular Weight | 536.99 g/mol |
| Exact Mass | 536.11 |
| IUPAC Name | bis[(3-fluorophenyl)methyl] (1R,2S,4S,5R,6R)-2-amino-4-(1H-1,2,4-triazol-5-ylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylate;hydrochloride |
| SMILES | Cl.N[C@@]1(C(=O)OCc2cccc(F)c2)C[C@H](Sc2ncn[nH]2)[C@H]2[C@H](C(=O)OCc3cccc(F)c3)[C@H]21 |
| InChI | InChI=1S/C24H22F2N4O4S.ClH/c25-15-5-1-3-13(7-15)10-33-21(31)19-18-17(35-23-28-12-29-30-23)9-24(27,20(18)19)22(32)34-11-14-4-2-6-16(26)8-14;/h1-8,12,17-20H,9-11,27H2,(H,28,29,30);1H/t17-,18-,19-,20-,24-;/m0./s1 |
| InChIKey | QSDCJJHAICOCAF-VEIUDTLCSA-N |
| XLogP | 3.42 |
| TPSA | 120.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.99 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |