C25H43F3O3Si — CID 140708869
tert-butyl-[(3S,4S,5R,6Z)-3-methoxy-5,7-dimethyl-8-[(2Z)-3-(trifluoromethyl)hepta-2,6-dienoxy]octa-1,6-dien-4-yl]oxy-dimethylsilane (PubChem CID 140708869) has the molecular formula C25H43F3O3Si and a molecular weight of 476.70 g/mol. Its IUPAC name is tert-butyl-[(3S,4S,5R,6Z)-3-methoxy-5,7-dimethyl-8-[(2Z)-3-(trifluoromethyl)hepta-2,6-dienoxy]octa-1,6-dien-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3S,4S,5R,6Z)-3-methoxy-5,7-dimethyl-8-[(2Z)-3-(trifluoromethyl)hepta-2,6-dienoxy]octa-1,6-dien-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 140708869 |
| Molecular Formula | C25H43F3O3Si |
| Molecular Weight | 476.70 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | tert-butyl-[(3S,4S,5R,6Z)-3-methoxy-5,7-dimethyl-8-[(2Z)-3-(trifluoromethyl)hepta-2,6-dienoxy]octa-1,6-dien-4-yl]oxy-dimethylsilane |
| SMILES | C=CCC/C(=C/COC/C(C)=C\[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C=C)OC)C(F)(F)F |
| InChI | InChI=1S/C25H43F3O3Si/c1-11-13-14-21(25(26,27)28)15-16-30-18-19(3)17-20(4)23(22(12-2)29-8)31-32(9,10)24(5,6)7/h11-12,15,17,20,22-23H,1-2,13-14,16,18H2,3-10H3/b19-17-,21-15-/t20-,22+,23+/m1/s1 |
| InChIKey | ZRWNFRVCCKLUKQ-OXQXMDQLSA-N |
| XLogP | 7.63 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.70 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|