C10H9IO2 — CID 140709227
(7-iodo-7-bicyclo[4.2.0]octa-1,3,5-trienyl) acetate (PubChem CID 140709227) has the molecular formula C10H9IO2 and a molecular weight of 288.08 g/mol. Its IUPAC name is (7-iodo-7-bicyclo[4.2.0]octa-1,3,5-trienyl) acetate.
| Compound Name | (7-iodo-7-bicyclo[4.2.0]octa-1,3,5-trienyl) acetate |
|---|---|
| PubChem CID | 140709227 |
| Molecular Formula | C10H9IO2 |
| Molecular Weight | 288.08 g/mol |
| Exact Mass | 287.96 |
| IUPAC Name | (7-iodo-7-bicyclo[4.2.0]octa-1,3,5-trienyl) acetate |
| SMILES | CC(=O)OC1(I)Cc2ccccc21 |
| InChI | InChI=1S/C10H9IO2/c1-7(12)13-10(11)6-8-4-2-3-5-9(8)10/h2-5H,6H2,1H3 |
| InChIKey | YLVYWWMDFXSYDN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.08 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|