C28H31N3O5 — CID 140709391
(1R,2S,5S,8R,10S,11R,15S,18R)-9,10,18-trihydroxy-12,12-dimethyl-6-methylidene-15-(4-phenyltriazol-1-yl)-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadec-13-en-7-one (PubChem CID 140709391) has the molecular formula C28H31N3O5 and a molecular weight of 489.57 g/mol. Its IUPAC name is (1R,2S,5S,8R,10S,11R,15S,18R)-9,10,18-trihydroxy-12,12-dimethyl-6-methylidene-15-(4-phenyltriazol-1-yl)-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadec-13-en-7-one.
| Compound Name | (1R,2S,5S,8R,10S,11R,15S,18R)-9,10,18-trihydroxy-12,12-dimethyl-6-methylidene-15-(4-phenyltriazol-1-yl)-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadec-13-en-7-one |
|---|---|
| PubChem CID | 140709391 |
| Molecular Formula | C28H31N3O5 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | (1R,2S,5S,8R,10S,11R,15S,18R)-9,10,18-trihydroxy-12,12-dimethyl-6-methylidene-15-(4-phenyltriazol-1-yl)-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadec-13-en-7-one |
| SMILES | C=C1C(=O)[C@]23[C@H](O)[C@H]1CC[C@H]2[C@@]12COC3(O)[C@@H](O)[C@@H]1C(C)(C)C=C[C@@H]2n1cc(-c2ccccc2)nn1 |
| InChI | InChI=1S/C28H31N3O5/c1-15-17-9-10-19-26-14-36-28(35,27(19,22(15)32)23(17)33)24(34)21(26)25(2,3)12-11-20(26)31-13-18(29-30-31)16-7-5-4-6-8-16/h4-8,11-13,17,19-21,23-24,33-35H,1,9-10,14H2,2-3H3/t17-,19-,20-,21+,23+,24-,26+,27-,28?/m0/s1 |
| InChIKey | KBIDHJWJQFXYPB-CMRYUCJVSA-N |
| XLogP | 2.29 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|