C23H30N5O4S+ — CID 140709432
N-[(2-amino-3H-pyridin-3-ylium-6-yl)sulfonyl]-6-(oxan-2-yl)-2-[(4S)-2,2,4-trimethylpyrrolidin-1-yl]pyridine-3-carboxamide (PubChem CID 140709432) has the molecular formula C23H30N5O4S+ and a molecular weight of 472.59 g/mol. Its IUPAC name is N-[(2-amino-3H-pyridin-3-ylium-6-yl)sulfonyl]-6-(oxan-2-yl)-2-[(4S)-2,2,4-trimethylpyrrolidin-1-yl]pyridine-3-carboxamide.
| Compound Name | N-[(2-amino-3H-pyridin-3-ylium-6-yl)sulfonyl]-6-(oxan-2-yl)-2-[(4S)-2,2,4-trimethylpyrrolidin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 140709432 |
| Molecular Formula | C23H30N5O4S+ |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | N-[(2-amino-3H-pyridin-3-ylium-6-yl)sulfonyl]-6-(oxan-2-yl)-2-[(4S)-2,2,4-trimethylpyrrolidin-1-yl]pyridine-3-carboxamide |
| SMILES | C[C@@H]1CN(c2nc(C3CCCCO3)ccc2C(=O)NS(=O)(=O)C2=NC(N)=[C+]C=C2)C(C)(C)C1 |
| InChI | InChI=1S/C23H29N5O4S/c1-15-13-23(2,3)28(14-15)21-16(10-11-17(25-21)18-7-4-5-12-32-18)22(29)27-33(30,31)20-9-6-8-19(24)26-20/h6,9-11,15,18H,4-5,7,12-14H2,1-3H3,(H2-,24,26,27,29)/p+1/t15-,18?/m0/s1 |
| InChIKey | BNYSKYYEGCNMAS-BUSXIPJBSA-O |
| XLogP | 2.58 |
| TPSA | 126.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|