About dibromo-bis(2,6-dimethylpiperidin-1-yl)silane
dibromo-bis(2,6-dimethylpiperidin-1-yl)silane (PubChem CID 140711240) has the molecular formula C14H28Br2N2Si
and a molecular weight of 412.29 g/mol. Its IUPAC name is dibromo-bis(2,6-dimethylpiperidin-1-yl)silane.
Molecular Properties
| Compound Name | dibromo-bis(2,6-dimethylpiperidin-1-yl)silane |
| PubChem CID | 140711240 |
| Molecular Formula | C14H28Br2N2Si |
| Molecular Weight | 412.29 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | dibromo-bis(2,6-dimethylpiperidin-1-yl)silane |
| SMILES | CC1CCCC(C)N1[Si](Br)(Br)N1C(C)CCCC1C |
| InChI | InChI=1S/C14H28Br2N2Si/c1-11-7-5-8-12(2)17(11)19(15,16)18-13(3)9-6-10-14(18)4/h11-14H,5-10H2,1-4H3 |
| InChIKey | MXCILZWZDROXRS-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.29 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze dibromo-bis(2,6-dimethylpiperidin-1-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibromo-bis(2,6-dimethylpiperidin-1-yl)silane?
The IUPAC name of dibromo-bis(2,6-dimethylpiperidin-1-yl)silane (CID 140711240) is dibromo-bis(2,6-dimethylpiperidin-1-yl)silane.
What is the SMILES notation for dibromo-bis(2,6-dimethylpiperidin-1-yl)silane?
The canonical SMILES for dibromo-bis(2,6-dimethylpiperidin-1-yl)silane is CC1CCCC(C)N1[Si](Br)(Br)N1C(C)CCCC1C.
What is the InChIKey of dibromo-bis(2,6-dimethylpiperidin-1-yl)silane?
The InChIKey is MXCILZWZDROXRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28Br2N2Si/c1-11-7-5-8-12(2)17(11)19(15,16)18-13(3)9-6-10-14(18)4/h11-14H,5-10H2,1-4H3.
What are the key properties of dibromo-bis(2,6-dimethylpiperidin-1-yl)silane?
dibromo-bis(2,6-dimethylpiperidin-1-yl)silane has a molecular weight of 412.29 g/mol, XLogP of 4.74, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dibromo-bis(2,6-dimethylpiperidin-1-yl)silane is sourced from PubChem (CID 140711240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).