C32H16F5N3O — CID 140711335
6-(2,3,4,5,6-pentafluorophenyl)-9-(5-phenylfuran-2-yl)-3-pyridin-2-ylpyrido[3,4-b]indole (PubChem CID 140711335) has the molecular formula C32H16F5N3O and a molecular weight of 553.49 g/mol. Its IUPAC name is 6-(2,3,4,5,6-pentafluorophenyl)-9-(5-phenylfuran-2-yl)-3-pyridin-2-ylpyrido[3,4-b]indole.
| Compound Name | 6-(2,3,4,5,6-pentafluorophenyl)-9-(5-phenylfuran-2-yl)-3-pyridin-2-ylpyrido[3,4-b]indole |
|---|---|
| PubChem CID | 140711335 |
| Molecular Formula | C32H16F5N3O |
| Molecular Weight | 553.49 g/mol |
| Exact Mass | 553.12 |
| IUPAC Name | 6-(2,3,4,5,6-pentafluorophenyl)-9-(5-phenylfuran-2-yl)-3-pyridin-2-ylpyrido[3,4-b]indole |
| SMILES | Fc1c(F)c(F)c(-c2ccc3c(c2)c2cc(-c4ccccn4)ncc2n3-c2ccc(-c3ccccc3)o2)c(F)c1F |
| InChI | InChI=1S/C32H16F5N3O/c33-28-27(29(34)31(36)32(37)30(28)35)18-9-10-23-19(14-18)20-15-22(21-8-4-5-13-38-21)39-16-24(20)40(23)26-12-11-25(41-26)17-6-2-1-3-7-17/h1-16H |
| InChIKey | SMRLTQWIBZDCBI-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.49 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|