C37H54N2O2 — CID 140712468
6-tert-butyl-3-[4-[[4-(6-tert-butyl-2,4,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazin-3-yl)phenyl]methyl]phenyl]-2,4,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazine (PubChem CID 140712468) has the molecular formula C37H54N2O2 and a molecular weight of 558.85 g/mol. Its IUPAC name is 6-tert-butyl-3-[4-[[4-(6-tert-butyl-2,4,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazin-3-yl)phenyl]methyl]phenyl]-2,4,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazine.
| Compound Name | 6-tert-butyl-3-[4-[[4-(6-tert-butyl-2,4,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazin-3-yl)phenyl]methyl]phenyl]-2,4,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 140712468 |
| Molecular Formula | C37H54N2O2 |
| Molecular Weight | 558.85 g/mol |
| Exact Mass | 558.42 |
| IUPAC Name | 6-tert-butyl-3-[4-[[4-(6-tert-butyl-2,4,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazin-3-yl)phenyl]methyl]phenyl]-2,4,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazine |
| SMILES | CC(C)(C)C1CCC2OCN(c3ccc(Cc4ccc(N5COC6CCC(C(C)(C)C)CC6C5)cc4)cc3)CC2C1 |
| InChI | InChI=1S/C37H54N2O2/c1-36(2,3)30-11-17-34-28(20-30)22-38(24-40-34)32-13-7-26(8-14-32)19-27-9-15-33(16-10-27)39-23-29-21-31(37(4,5)6)12-18-35(29)41-25-39/h7-10,13-16,28-31,34-35H,11-12,17-25H2,1-6H3 |
| InChIKey | UVFYHJHVPZSNSD-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.85 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|