C33H34BN3 — CID 140712954
[3-[2-(2-methylphenyl)-1,2,4-triazol-3-yl]phenyl]-bis(2,4,6-trimethylphenyl)borane (PubChem CID 140712954) has the molecular formula C33H34BN3 and a molecular weight of 483.47 g/mol. Its IUPAC name is [3-[2-(2-methylphenyl)-1,2,4-triazol-3-yl]phenyl]-bis(2,4,6-trimethylphenyl)borane.
| Compound Name | [3-[2-(2-methylphenyl)-1,2,4-triazol-3-yl]phenyl]-bis(2,4,6-trimethylphenyl)borane |
|---|---|
| PubChem CID | 140712954 |
| Molecular Formula | C33H34BN3 |
| Molecular Weight | 483.47 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | [3-[2-(2-methylphenyl)-1,2,4-triazol-3-yl]phenyl]-bis(2,4,6-trimethylphenyl)borane |
| SMILES | Cc1cc(C)c(B(c2cccc(-c3ncnn3-c3ccccc3C)c2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C33H34BN3/c1-21-15-24(4)31(25(5)16-21)34(32-26(6)17-22(2)18-27(32)7)29-13-10-12-28(19-29)33-35-20-36-37(33)30-14-9-8-11-23(30)3/h8-20H,1-7H3 |
| InChIKey | XHNFGIXCWCZUCC-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.47 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|