C31H19N2OP — CID 140713872
5-(4-isocyanophenyl)-12-phenylphosphindolo[3,2-c]carbazole 12-oxide (PubChem CID 140713872) has the molecular formula C31H19N2OP and a molecular weight of 466.48 g/mol. Its IUPAC name is 5-(4-isocyanophenyl)-12-phenylphosphindolo[3,2-c]carbazole 12-oxide.
| Compound Name | 5-(4-isocyanophenyl)-12-phenylphosphindolo[3,2-c]carbazole 12-oxide |
|---|---|
| PubChem CID | 140713872 |
| Molecular Formula | C31H19N2OP |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | 5-(4-isocyanophenyl)-12-phenylphosphindolo[3,2-c]carbazole 12-oxide |
| SMILES | [C-]#[N+]c1ccc(-n2c3ccccc3c3c4c(ccc32)-c2ccccc2P4(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H19N2OP/c1-32-21-15-17-22(18-16-21)33-27-13-7-5-12-26(27)30-28(33)20-19-25-24-11-6-8-14-29(24)35(34,31(25)30)23-9-3-2-4-10-23/h2-20H |
| InChIKey | XWOJTNDPMGWSRW-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 26.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|