About 2-[chloro(difluoro)methyl]-2-nitropropane-1,3-diol
2-[chloro(difluoro)methyl]-2-nitropropane-1,3-diol (PubChem CID 14071414) has the molecular formula C4H6ClF2NO4
and a molecular weight of 205.54 g/mol. Its IUPAC name is 2-[chloro(difluoro)methyl]-2-nitropropane-1,3-diol.
Molecular Properties
| Compound Name | 2-[chloro(difluoro)methyl]-2-nitropropane-1,3-diol |
| PubChem CID | 14071414 |
| Molecular Formula | C4H6ClF2NO4 |
| Molecular Weight | 205.54 g/mol |
| Exact Mass | 205.00 |
| IUPAC Name | 2-[chloro(difluoro)methyl]-2-nitropropane-1,3-diol |
| SMILES | O=[N+]([O-])C(CO)(CO)C(F)(F)Cl |
| InChI | InChI=1S/C4H6ClF2NO4/c5-4(6,7)3(1-9,2-10)8(11)12/h9-10H,1-2H2 |
| InChIKey | JQVHMTVGMHEMGS-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.54 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[chloro(difluoro)methyl]-2-nitropropane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[chloro(difluoro)methyl]-2-nitropropane-1,3-diol?
The IUPAC name of 2-[chloro(difluoro)methyl]-2-nitropropane-1,3-diol (CID 14071414) is 2-[chloro(difluoro)methyl]-2-nitropropane-1,3-diol.
What is the SMILES notation for 2-[chloro(difluoro)methyl]-2-nitropropane-1,3-diol?
The canonical SMILES for 2-[chloro(difluoro)methyl]-2-nitropropane-1,3-diol is O=[N+]([O-])C(CO)(CO)C(F)(F)Cl.
What is the InChIKey of 2-[chloro(difluoro)methyl]-2-nitropropane-1,3-diol?
The InChIKey is JQVHMTVGMHEMGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6ClF2NO4/c5-4(6,7)3(1-9,2-10)8(11)12/h9-10H,1-2H2.
What are the key properties of 2-[chloro(difluoro)methyl]-2-nitropropane-1,3-diol?
2-[chloro(difluoro)methyl]-2-nitropropane-1,3-diol has a molecular weight of 205.54 g/mol, XLogP of -0.18, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[chloro(difluoro)methyl]-2-nitropropane-1,3-diol is sourced from PubChem (CID 14071414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).