C19H37FO4Si2 — CID 140714181
(6aR,8R,9S)-9-fluoro-7-methylidene-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-cyclopenta[f][1,3,5,2,4]trioxadisilocin-8-ol (PubChem CID 140714181) has the molecular formula C19H37FO4Si2 and a molecular weight of 404.67 g/mol. Its IUPAC name is (6aR,8R,9S)-9-fluoro-7-methylidene-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-cyclopenta[f][1,3,5,2,4]trioxadisilocin-8-ol.
| Compound Name | (6aR,8R,9S)-9-fluoro-7-methylidene-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-cyclopenta[f][1,3,5,2,4]trioxadisilocin-8-ol |
|---|---|
| PubChem CID | 140714181 |
| Molecular Formula | C19H37FO4Si2 |
| Molecular Weight | 404.67 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | (6aR,8R,9S)-9-fluoro-7-methylidene-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-cyclopenta[f][1,3,5,2,4]trioxadisilocin-8-ol |
| SMILES | C=C1[C@@H](O)[C@H](F)C2O[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)OC[C@@H]12 |
| InChI | InChI=1S/C19H37FO4Si2/c1-11(2)25(12(3)4)22-10-16-15(9)18(21)17(20)19(16)23-26(24-25,13(5)6)14(7)8/h11-14,16-19,21H,9-10H2,1-8H3/t16-,17-,18+,19?/m0/s1 |
| InChIKey | CNFFFWUBYRHIHK-HTUJPFKRSA-N |
| XLogP | 4.83 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.67 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|