About deuterio N-(aminomethyl)carbamate
deuterio N-(aminomethyl)carbamate (PubChem CID 140714222) has the molecular formula C2H6N2O2
and a molecular weight of 91.09 g/mol. Its IUPAC name is deuterio N-(aminomethyl)carbamate.
Molecular Properties
| Compound Name | deuterio N-(aminomethyl)carbamate |
| PubChem CID | 140714222 |
| Molecular Formula | C2H6N2O2 |
| Molecular Weight | 91.09 g/mol |
| Exact Mass | 91.05 |
| IUPAC Name | deuterio N-(aminomethyl)carbamate |
| SMILES | [2H]OC(=O)NCN |
| InChI | InChI=1S/C2H6N2O2/c3-1-4-2(5)6/h4H,1,3H2,(H,5,6)/i/hD |
| InChIKey | HHFJXGNFTBSDLF-DYCDLGHISA-N |
| XLogP | -0.83 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 91.09 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze deuterio N-(aminomethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of deuterio N-(aminomethyl)carbamate?
The IUPAC name of deuterio N-(aminomethyl)carbamate (CID 140714222) is deuterio N-(aminomethyl)carbamate.
What is the SMILES notation for deuterio N-(aminomethyl)carbamate?
The canonical SMILES for deuterio N-(aminomethyl)carbamate is [2H]OC(=O)NCN.
What is the InChIKey of deuterio N-(aminomethyl)carbamate?
The InChIKey is HHFJXGNFTBSDLF-DYCDLGHISA-N. The full InChI is InChI=1S/C2H6N2O2/c3-1-4-2(5)6/h4H,1,3H2,(H,5,6)/i/hD.
What are the key properties of deuterio N-(aminomethyl)carbamate?
deuterio N-(aminomethyl)carbamate has a molecular weight of 91.09 g/mol, XLogP of -0.83, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for deuterio N-(aminomethyl)carbamate is sourced from PubChem (CID 140714222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).