C21H14N2O — CID 140714857
1-(4-dibenzofuran-3-ylphenyl)pyrazole (PubChem CID 140714857) has the molecular formula C21H14N2O and a molecular weight of 310.36 g/mol. Its IUPAC name is 1-(4-dibenzofuran-3-ylphenyl)pyrazole.
| Compound Name | 1-(4-dibenzofuran-3-ylphenyl)pyrazole |
|---|---|
| PubChem CID | 140714857 |
| Molecular Formula | C21H14N2O |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 1-(4-dibenzofuran-3-ylphenyl)pyrazole |
| SMILES | c1ccc2c(c1)oc1cc(-c3ccc(-n4cccn4)cc3)ccc12 |
| InChI | InChI=1S/C21H14N2O/c1-2-5-20-18(4-1)19-11-8-16(14-21(19)24-20)15-6-9-17(10-7-15)23-13-3-12-22-23/h1-14H |
| InChIKey | REMHEQDPYCKHCS-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |