C33H29N3SSi — CID 140716641
10-(3-pyridin-2-ylphenyl)-2-(1-pyridin-2-ylsilinan-1-yl)phenothiazine (PubChem CID 140716641) has the molecular formula C33H29N3SSi and a molecular weight of 527.77 g/mol. Its IUPAC name is 10-(3-pyridin-2-ylphenyl)-2-(1-pyridin-2-ylsilinan-1-yl)phenothiazine.
| Compound Name | 10-(3-pyridin-2-ylphenyl)-2-(1-pyridin-2-ylsilinan-1-yl)phenothiazine |
|---|---|
| PubChem CID | 140716641 |
| Molecular Formula | C33H29N3SSi |
| Molecular Weight | 527.77 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | 10-(3-pyridin-2-ylphenyl)-2-(1-pyridin-2-ylsilinan-1-yl)phenothiazine |
| SMILES | c1ccc(-c2cccc(N3c4ccccc4Sc4ccc([Si]5(c6ccccn6)CCCCC5)cc43)c2)nc1 |
| InChI | InChI=1S/C33H29N3SSi/c1-8-21-38(22-9-1,33-16-5-7-20-35-33)27-17-18-32-30(24-27)36(29-14-2-3-15-31(29)37-32)26-12-10-11-25(23-26)28-13-4-6-19-34-28/h2-7,10-20,23-24H,1,8-9,21-22H2 |
| InChIKey | DBNHKDYKNGRSTE-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.77 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|