About butyl-(5-butylazanidyl-2,4-dihydroxycyclohexyl)azanide;bis(gold(1+))
butyl-(5-butylazanidyl-2,4-dihydroxycyclohexyl)azanide;bis(gold(1+)) (PubChem CID 140717551) has the molecular formula C14H26Au2N2O2
and a molecular weight of 648.31 g/mol. Its IUPAC name is butyl-(5-butylazanidyl-2,4-dihydroxycyclohexyl)azanide;bis(gold(1+)).
Molecular Properties
| Compound Name | butyl-(5-butylazanidyl-2,4-dihydroxycyclohexyl)azanide;bis(gold(1+)) |
| PubChem CID | 140717551 |
| Molecular Formula | C14H26Au2N2O2 |
| Molecular Weight | 648.31 g/mol |
| Exact Mass | 648.13 |
| IUPAC Name | butyl-(5-butylazanidyl-2,4-dihydroxycyclohexyl)azanide;bis(gold(1+)) |
| SMILES | CCCC[N-]C1[CH+]C([N-]CCCC)C(O)[CH-]C1O.[Au+].[Au+] |
| InChI | InChI=1S/C14H26N2O2.2Au/c1-3-5-7-15-11-9-12(16-8-6-4-2)14(18)10-13(11)17;;/h9-14,17-18H,3-8H2,1-2H3;;/q-2;2*+1 |
| InChIKey | DYVYSXWRVUODIH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 68.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 648.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze butyl-(5-butylazanidyl-2,4-dihydroxycyclohexyl)azanide;bis(gold(1+)) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl-(5-butylazanidyl-2,4-dihydroxycyclohexyl)azanide;bis(gold(1+))?
The IUPAC name of butyl-(5-butylazanidyl-2,4-dihydroxycyclohexyl)azanide;bis(gold(1+)) (CID 140717551) is butyl-(5-butylazanidyl-2,4-dihydroxycyclohexyl)azanide;bis(gold(1+)).
What is the SMILES notation for butyl-(5-butylazanidyl-2,4-dihydroxycyclohexyl)azanide;bis(gold(1+))?
The canonical SMILES for butyl-(5-butylazanidyl-2,4-dihydroxycyclohexyl)azanide;bis(gold(1+)) is CCCC[N-]C1[CH+]C([N-]CCCC)C(O)[CH-]C1O.[Au+].[Au+].
What is the InChIKey of butyl-(5-butylazanidyl-2,4-dihydroxycyclohexyl)azanide;bis(gold(1+))?
The InChIKey is DYVYSXWRVUODIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O2.2Au/c1-3-5-7-15-11-9-12(16-8-6-4-2)14(18)10-13(11)17;;/h9-14,17-18H,3-8H2,1-2H3;;/q-2;2*+1.
What are the key properties of butyl-(5-butylazanidyl-2,4-dihydroxycyclohexyl)azanide;bis(gold(1+))?
butyl-(5-butylazanidyl-2,4-dihydroxycyclohexyl)azanide;bis(gold(1+)) has a molecular weight of 648.31 g/mol, XLogP of 2.21, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butyl-(5-butylazanidyl-2,4-dihydroxycyclohexyl)azanide;bis(gold(1+)) is sourced from PubChem (CID 140717551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).