C29H22BrNO7S2 — CID 140717866
2-(8-bromo-3-oxa-21-azoniahexacyclo[15.7.1.02,15.04,13.05,10.021,25]pentacosa-1,4(13),5(10),6,8,11,14,16,21(25)-nonaen-14-yl)-5-sulfobenzenesulfonate (PubChem CID 140717866) has the molecular formula C29H22BrNO7S2 and a molecular weight of 640.53 g/mol. Its IUPAC name is 2-(8-bromo-3-oxa-21-azoniahexacyclo[15.7.1.02,15.04,13.05,10.021,25]pentacosa-1,4(13),5(10),6,8,11,14,16,21(25)-nonaen-14-yl)-5-sulfobenzenesulfonate.
| Compound Name | 2-(8-bromo-3-oxa-21-azoniahexacyclo[15.7.1.02,15.04,13.05,10.021,25]pentacosa-1,4(13),5(10),6,8,11,14,16,21(25)-nonaen-14-yl)-5-sulfobenzenesulfonate |
|---|---|
| PubChem CID | 140717866 |
| Molecular Formula | C29H22BrNO7S2 |
| Molecular Weight | 640.53 g/mol |
| Exact Mass | 639.00 |
| IUPAC Name | 2-(8-bromo-3-oxa-21-azoniahexacyclo[15.7.1.02,15.04,13.05,10.021,25]pentacosa-1,4(13),5(10),6,8,11,14,16,21(25)-nonaen-14-yl)-5-sulfobenzenesulfonate |
| SMILES | O=S(=O)([O-])c1cc(S(=O)(=O)O)ccc1C1=c2cc3c4c(c2Oc2c1ccc1cc(Br)ccc21)CCC[N+]=4CCC3 |
| InChI | InChI=1S/C29H22BrNO7S2/c30-18-6-9-20-16(13-18)5-8-22-26(21-10-7-19(39(32,33)34)15-25(21)40(35,36)37)24-14-17-3-1-11-31-12-2-4-23(27(17)31)29(24)38-28(20)22/h5-10,13-15H,1-4,11-12H2,(H-,32,33,34,35,36,37) |
| InChIKey | NUIXPVMGJLQHJA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 123.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|