C23H19F3N4OS — CID 140718337
4-(5-isocyano-4-phenyl-1,3-thiazol-2-yl)-N-[4-(trifluoromethyl)phenyl]piperidine-1-carboxamide (PubChem CID 140718337) has the molecular formula C23H19F3N4OS and a molecular weight of 456.49 g/mol. Its IUPAC name is 4-(5-isocyano-4-phenyl-1,3-thiazol-2-yl)-N-[4-(trifluoromethyl)phenyl]piperidine-1-carboxamide.
| Compound Name | 4-(5-isocyano-4-phenyl-1,3-thiazol-2-yl)-N-[4-(trifluoromethyl)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 140718337 |
| Molecular Formula | C23H19F3N4OS |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 4-(5-isocyano-4-phenyl-1,3-thiazol-2-yl)-N-[4-(trifluoromethyl)phenyl]piperidine-1-carboxamide |
| SMILES | [C-]#[N+]c1sc(C2CCN(C(=O)Nc3ccc(C(F)(F)F)cc3)CC2)nc1-c1ccccc1 |
| InChI | InChI=1S/C23H19F3N4OS/c1-27-21-19(15-5-3-2-4-6-15)29-20(32-21)16-11-13-30(14-12-16)22(31)28-18-9-7-17(8-10-18)23(24,25)26/h2-10,16H,11-14H2,(H,28,31) |
| InChIKey | BKKMQYWNVGOIRR-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 49.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|