1,5-diamino-4-chlorocyclohexa-2,4-diene-1-carboxylic acid

C7H9ClN2O2 — CID 140718888

IUPAC1,5-diamino-4-chlorocyclohexa-2,4-diene-1-carboxylic acid
SMILESNC1=C(Cl)C=CC(N)(C(=O)O)C1
InChIInChI=1S/C7H9ClN2O2/c8-4-1-2-7(10,6(11)12)3-5(4)9/h1-2H,3,9-10H2,(H,11,12)
InChIKeyLFAMEPXTCIPXRW-UHFFFAOYSA-N
MW188.61 g/mol
LogP0.14
Rot. Bonds1

About 1,5-diamino-4-chlorocyclohexa-2,4-diene-1-carboxylic acid

1,5-diamino-4-chlorocyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 140718888) has the molecular formula C7H9ClN2O2 and a molecular weight of 188.61 g/mol. Its IUPAC name is 1,5-diamino-4-chlorocyclohexa-2,4-diene-1-carboxylic acid.

Molecular Properties

Compound Name1,5-diamino-4-chlorocyclohexa-2,4-diene-1-carboxylic acid
PubChem CID140718888
Molecular FormulaC7H9ClN2O2
Molecular Weight188.61 g/mol
Exact Mass188.04
IUPAC Name1,5-diamino-4-chlorocyclohexa-2,4-diene-1-carboxylic acid
SMILESNC1=C(Cl)C=CC(N)(C(=O)O)C1
InChIInChI=1S/C7H9ClN2O2/c8-4-1-2-7(10,6(11)12)3-5(4)9/h1-2H,3,9-10H2,(H,11,12)
InChIKeyLFAMEPXTCIPXRW-UHFFFAOYSA-N
XLogP0.14
TPSA89.34 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.61
LogP ≤ 50.14
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 1,5-diamino-4-chlorocyclohexa-2,4-diene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,5-diamino-4-chlorocyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 1,5-diamino-4-chlorocyclohexa-2,4-diene-1-carboxylic acid (CID 140718888) is 1,5-diamino-4-chlorocyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 1,5-diamino-4-chlorocyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 1,5-diamino-4-chlorocyclohexa-2,4-diene-1-carboxylic acid is NC1=C(Cl)C=CC(N)(C(=O)O)C1.
What is the InChIKey of 1,5-diamino-4-chlorocyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is LFAMEPXTCIPXRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN2O2/c8-4-1-2-7(10,6(11)12)3-5(4)9/h1-2H,3,9-10H2,(H,11,12).
What are the key properties of 1,5-diamino-4-chlorocyclohexa-2,4-diene-1-carboxylic acid?
1,5-diamino-4-chlorocyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 188.61 g/mol, XLogP of 0.14, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-diamino-4-chlorocyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 140718888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).