About 1,5-diamino-4-chlorocyclohexa-2,4-diene-1-carboxylic acid
1,5-diamino-4-chlorocyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 140718888) has the molecular formula C7H9ClN2O2
and a molecular weight of 188.61 g/mol. Its IUPAC name is 1,5-diamino-4-chlorocyclohexa-2,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 1,5-diamino-4-chlorocyclohexa-2,4-diene-1-carboxylic acid |
| PubChem CID | 140718888 |
| Molecular Formula | C7H9ClN2O2 |
| Molecular Weight | 188.61 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | 1,5-diamino-4-chlorocyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | NC1=C(Cl)C=CC(N)(C(=O)O)C1 |
| InChI | InChI=1S/C7H9ClN2O2/c8-4-1-2-7(10,6(11)12)3-5(4)9/h1-2H,3,9-10H2,(H,11,12) |
| InChIKey | LFAMEPXTCIPXRW-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.61 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,5-diamino-4-chlorocyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-diamino-4-chlorocyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 1,5-diamino-4-chlorocyclohexa-2,4-diene-1-carboxylic acid (CID 140718888) is 1,5-diamino-4-chlorocyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 1,5-diamino-4-chlorocyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 1,5-diamino-4-chlorocyclohexa-2,4-diene-1-carboxylic acid is NC1=C(Cl)C=CC(N)(C(=O)O)C1.
What is the InChIKey of 1,5-diamino-4-chlorocyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is LFAMEPXTCIPXRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN2O2/c8-4-1-2-7(10,6(11)12)3-5(4)9/h1-2H,3,9-10H2,(H,11,12).
What are the key properties of 1,5-diamino-4-chlorocyclohexa-2,4-diene-1-carboxylic acid?
1,5-diamino-4-chlorocyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 188.61 g/mol, XLogP of 0.14, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-diamino-4-chlorocyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 140718888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).