C19H19FN4O2 — CID 140719209
1-[3-cyclopropyl-2-[(2-fluoro-6-methylphenoxy)methyl]phenyl]-4-methyltetrazol-5-one (PubChem CID 140719209) has the molecular formula C19H19FN4O2 and a molecular weight of 354.39 g/mol. Its IUPAC name is 1-[3-cyclopropyl-2-[(2-fluoro-6-methylphenoxy)methyl]phenyl]-4-methyltetrazol-5-one.
| Compound Name | 1-[3-cyclopropyl-2-[(2-fluoro-6-methylphenoxy)methyl]phenyl]-4-methyltetrazol-5-one |
|---|---|
| PubChem CID | 140719209 |
| Molecular Formula | C19H19FN4O2 |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 1-[3-cyclopropyl-2-[(2-fluoro-6-methylphenoxy)methyl]phenyl]-4-methyltetrazol-5-one |
| SMILES | Cc1cccc(F)c1OCc1c(C2CC2)cccc1-n1nnn(C)c1=O |
| InChI | InChI=1S/C19H19FN4O2/c1-12-5-3-7-16(20)18(12)26-11-15-14(13-9-10-13)6-4-8-17(15)24-19(25)23(2)21-22-24/h3-8,13H,9-11H2,1-2H3 |
| InChIKey | LNWKLMRWEJKOIU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |