C38H43IrN3OSi2-2 — CID 140719874
iridium;trimethyl-[6-(2-methyl-7H-[1]benzofuro[2,3-b]pyridin-7-id-6-yl)-4-(2-methylpropyl)-3-pyridinyl]silane;trimethyl-(6-phenyl-3-pyridinyl)silane (PubChem CID 140719874) has the molecular formula C38H43IrN3OSi2-2 and a molecular weight of 806.17 g/mol. Its IUPAC name is iridium;trimethyl-[6-(2-methyl-7H-[1]benzofuro[2,3-b]pyridin-7-id-6-yl)-4-(2-methylpropyl)-3-pyridinyl]silane;trimethyl-(6-phenyl-3-pyridinyl)silane.
| Compound Name | iridium;trimethyl-[6-(2-methyl-7H-[1]benzofuro[2,3-b]pyridin-7-id-6-yl)-4-(2-methylpropyl)-3-pyridinyl]silane;trimethyl-(6-phenyl-3-pyridinyl)silane |
|---|---|
| PubChem CID | 140719874 |
| Molecular Formula | C38H43IrN3OSi2-2 |
| Molecular Weight | 806.17 g/mol |
| Exact Mass | 806.26 |
| IUPAC Name | iridium;trimethyl-[6-(2-methyl-7H-[1]benzofuro[2,3-b]pyridin-7-id-6-yl)-4-(2-methylpropyl)-3-pyridinyl]silane;trimethyl-(6-phenyl-3-pyridinyl)silane |
| SMILES | C[Si](C)(C)c1ccc(-c2[c-]cccc2)nc1.Cc1ccc2c(n1)oc1c[c-]c(-c3cc(CC(C)C)c([Si](C)(C)C)cn3)cc12.[Ir] |
| InChI | InChI=1S/C24H27N2OSi.C14H16NSi.Ir/c1-15(2)11-18-13-21(25-14-23(18)28(4,5)6)17-8-10-22-20(12-17)19-9-7-16(3)26-24(19)27-22;1-16(2,3)13-9-10-14(15-11-13)12-7-5-4-6-8-12;/h7,9-10,12-15H,11H2,1-6H3;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | ACUZHDRSWFEVJV-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.17 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|