About [6-(5,5-dioxodibenzothiophen-4-yl)-4-ethyl-3-pyridinyl]-trimethylsilane
[6-(5,5-dioxodibenzothiophen-4-yl)-4-ethyl-3-pyridinyl]-trimethylsilane (PubChem CID 140720127) has the molecular formula C22H23NO2SSi
and a molecular weight of 393.58 g/mol. Its IUPAC name is [6-(5,5-dioxodibenzothiophen-4-yl)-4-ethyl-3-pyridinyl]-trimethylsilane.
Molecular Properties
| Compound Name | [6-(5,5-dioxodibenzothiophen-4-yl)-4-ethyl-3-pyridinyl]-trimethylsilane |
| PubChem CID | 140720127 |
| Molecular Formula | C22H23NO2SSi |
| Molecular Weight | 393.58 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | [6-(5,5-dioxodibenzothiophen-4-yl)-4-ethyl-3-pyridinyl]-trimethylsilane |
| SMILES | CCc1cc(-c2cccc3c2S(=O)(=O)c2ccccc2-3)ncc1[Si](C)(C)C |
| InChI | InChI=1S/C22H23NO2SSi/c1-5-15-13-19(23-14-21(15)27(2,3)4)18-11-8-10-17-16-9-6-7-12-20(16)26(24,25)22(17)18/h6-14H,5H2,1-4H3 |
| InChIKey | NLQKRXZIFJOCDS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.58 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [6-(5,5-dioxodibenzothiophen-4-yl)-4-ethyl-3-pyridinyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(5,5-dioxodibenzothiophen-4-yl)-4-ethyl-3-pyridinyl]-trimethylsilane?
The IUPAC name of [6-(5,5-dioxodibenzothiophen-4-yl)-4-ethyl-3-pyridinyl]-trimethylsilane (CID 140720127) is [6-(5,5-dioxodibenzothiophen-4-yl)-4-ethyl-3-pyridinyl]-trimethylsilane.
What is the SMILES notation for [6-(5,5-dioxodibenzothiophen-4-yl)-4-ethyl-3-pyridinyl]-trimethylsilane?
The canonical SMILES for [6-(5,5-dioxodibenzothiophen-4-yl)-4-ethyl-3-pyridinyl]-trimethylsilane is CCc1cc(-c2cccc3c2S(=O)(=O)c2ccccc2-3)ncc1[Si](C)(C)C.
What is the InChIKey of [6-(5,5-dioxodibenzothiophen-4-yl)-4-ethyl-3-pyridinyl]-trimethylsilane?
The InChIKey is NLQKRXZIFJOCDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23NO2SSi/c1-5-15-13-19(23-14-21(15)27(2,3)4)18-11-8-10-17-16-9-6-7-12-20(16)26(24,25)22(17)18/h6-14H,5H2,1-4H3.
What are the key properties of [6-(5,5-dioxodibenzothiophen-4-yl)-4-ethyl-3-pyridinyl]-trimethylsilane?
[6-(5,5-dioxodibenzothiophen-4-yl)-4-ethyl-3-pyridinyl]-trimethylsilane has a molecular weight of 393.58 g/mol, XLogP of 4.67, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(5,5-dioxodibenzothiophen-4-yl)-4-ethyl-3-pyridinyl]-trimethylsilane is sourced from PubChem (CID 140720127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).