C17H28O6 — CID 140720878
4,4-bis(2-hydroxy-2-methylpropoxy)-2,3-dimethylcyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 140720878) has the molecular formula C17H28O6 and a molecular weight of 328.41 g/mol. Its IUPAC name is 4,4-bis(2-hydroxy-2-methylpropoxy)-2,3-dimethylcyclohexa-1,5-diene-1-carboxylic acid.
| Compound Name | 4,4-bis(2-hydroxy-2-methylpropoxy)-2,3-dimethylcyclohexa-1,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 140720878 |
| Molecular Formula | C17H28O6 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 4,4-bis(2-hydroxy-2-methylpropoxy)-2,3-dimethylcyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | CC1=C(C(=O)O)C=CC(OCC(C)(C)O)(OCC(C)(C)O)C1C |
| InChI | InChI=1S/C17H28O6/c1-11-12(2)17(22-9-15(3,4)20,23-10-16(5,6)21)8-7-13(11)14(18)19/h7-8,12,20-21H,9-10H2,1-6H3,(H,18,19) |
| InChIKey | QQPLQKGLUCPDQI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|