C19H27BF2O4S — CID 140722292
ethyl 5-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfanylpentanoate (PubChem CID 140722292) has the molecular formula C19H27BF2O4S and a molecular weight of 400.30 g/mol. Its IUPAC name is ethyl 5-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfanylpentanoate.
| Compound Name | ethyl 5-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfanylpentanoate |
|---|---|
| PubChem CID | 140722292 |
| Molecular Formula | C19H27BF2O4S |
| Molecular Weight | 400.30 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | ethyl 5-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfanylpentanoate |
| SMILES | CCOC(=O)CCCCSc1c(F)cc(B2OC(C)(C)C(C)(C)O2)cc1F |
| InChI | InChI=1S/C19H27BF2O4S/c1-6-24-16(23)9-7-8-10-27-17-14(21)11-13(12-15(17)22)20-25-18(2,3)19(4,5)26-20/h11-12H,6-10H2,1-5H3 |
| InChIKey | BWQKYITVMABYTA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.30 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|