C16H21BF2O4S — CID 140722302
methyl 2-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfanylpropanoate (PubChem CID 140722302) has the molecular formula C16H21BF2O4S and a molecular weight of 358.22 g/mol. Its IUPAC name is methyl 2-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfanylpropanoate.
| Compound Name | methyl 2-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 140722302 |
| Molecular Formula | C16H21BF2O4S |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | methyl 2-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfanylpropanoate |
| SMILES | COC(=O)C(C)Sc1c(F)cc(B2OC(C)(C)C(C)(C)O2)cc1F |
| InChI | InChI=1S/C16H21BF2O4S/c1-9(14(20)21-6)24-13-11(18)7-10(8-12(13)19)17-22-15(2,3)16(4,5)23-17/h7-9H,1-6H3 |
| InChIKey | ZEFPMEIMNMYAEE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|