C20H29BF2O4S — CID 140722305
ethyl 6-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfanylhexanoate (PubChem CID 140722305) has the molecular formula C20H29BF2O4S and a molecular weight of 414.32 g/mol. Its IUPAC name is ethyl 6-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfanylhexanoate.
| Compound Name | ethyl 6-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfanylhexanoate |
|---|---|
| PubChem CID | 140722305 |
| Molecular Formula | C20H29BF2O4S |
| Molecular Weight | 414.32 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | ethyl 6-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfanylhexanoate |
| SMILES | CCOC(=O)CCCCCSc1c(F)cc(B2OC(C)(C)C(C)(C)O2)cc1F |
| InChI | InChI=1S/C20H29BF2O4S/c1-6-25-17(24)10-8-7-9-11-28-18-15(22)12-14(13-16(18)23)21-26-19(2,3)20(4,5)27-21/h12-13H,6-11H2,1-5H3 |
| InChIKey | BCONHUFFJLNEKF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.32 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|